Products 4488-43-1
CAS 4488-43-1 appears in our catalog under these names: 5-Acenaphthylenecarboxylic acid, 5–Acenaphthylenecarboxylic acid, acenaphthylene-5-carboxylic acid, 95%, 95%. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 5mg, 250mg, 1g.
Acenaphthylene-5-carboxylic acid (CAS 4488-43-1) is a chemical compound with the molecular formula C13H8O2 and a molecular weight of 196.20 g/mol. IUPAC name: acenaphthylene-5-carboxylic acid. InChIKey: CZVILAASJKYMAM-UHFFFAOYSA-N.
| Molecular formula | C13H8O2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | acenaphthylene-5-carboxylic acid |
| InChIKey | CZVILAASJKYMAM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=CC=C(C3=C1)C(=O)O)C=C2 |
Computed by PubChem (NCBI)