Products 450368-34-0

CAS 450368-34-0 is the registry number for 1-methyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic Acid (85%), >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

1-methyl-3-oxo-2,4-dihydroquinoxaline-6-carboxylic acid (CAS 450368-34-0) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 1-methyl-3-oxo-2,4-dihydroquinoxaline-6-carboxylic acid. InChIKey: ZQAREAJRBFNQEW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O3
Molecular weight206.20 g/mol
IUPAC name1-methyl-3-oxo-2,4-dihydroquinoxaline-6-carboxylic acid
InChIKeyZQAREAJRBFNQEW-UHFFFAOYSA-N
SMILESCN1CC(=O)NC2=C1C=CC(=C2)C(=O)O

Computed by PubChem (NCBI)