Products 452077-89-3

CAS 452077-89-3 is the registry number for MF-PGDH-008, 98.79%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 10 mg, 10mM/1mL, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

[1-(4-methoxyphenyl)benzimidazol-5-yl]-piperidin-1-ylmethanone (CAS 452077-89-3) is a chemical compound with the molecular formula C20H21N3O2 and a molecular weight of 335.4 g/mol. IUPAC name: [1-(4-methoxyphenyl)benzimidazol-5-yl]-piperidin-1-ylmethanone. InChIKey: FUCWZIFGSAFUAO-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21N3O2
Molecular weight335.4 g/mol
IUPAC name[1-(4-methoxyphenyl)benzimidazol-5-yl]-piperidin-1-ylmethanone
InChIKeyFUCWZIFGSAFUAO-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N2C=NC3=C2C=CC(=C3)C(=O)N4CCCCC4

Computed by PubChem (NCBI)