CAS 4530-45-4 appears in our catalog under these names: 3-(Dichloromethyl)phenyl acetate, 3-(Dichloromethyl)phenyl Acetate, 99%+(GC-MS),RG, 99%+(GC-MS),RG. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g.
[3-(dichloromethyl)phenyl] acetate (CAS 4530-45-4) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: [3-(dichloromethyl)phenyl] acetate. InChIKey: NDFSVZCNYDLXOU-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | [3-(dichloromethyl)phenyl] acetate |
| InChIKey | NDFSVZCNYDLXOU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C(Cl)Cl |
Computed by PubChem (NCBI)