CAS 4566-82-9 appears in our catalog under these names: Dimethyl 4-methylpyridine-2,6-dicarboxylate 95+%, Dimethyl 4-methylpyridine-2,6-dicarboxylate, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Dimethyl 4-methylpyridine-2,6-dicarboxylate (CAS 4566-82-9) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: dimethyl 4-methylpyridine-2,6-dicarboxylate. InChIKey: FMIPAXVAQJKQCV-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | dimethyl 4-methylpyridine-2,6-dicarboxylate |
| InChIKey | FMIPAXVAQJKQCV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)