Products 457628-14-7
CAS 457628-14-7 appears in our catalog under these names: 6-Fluoro-2,3-dimethoxybenzaldehyde, 95%, 6-Fluoro-2,3-dimethoxybenzaldehyde, 98%, 2,3-Dimethoxy-6-fluorobenzaldehyde, 6-Fluoro-2,3-dimethoxybenzaldehyde, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 1g, 250mg, 0,5g.
6-fluoro-2,3-dimethoxybenzaldehyde (CAS 457628-14-7) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 6-fluoro-2,3-dimethoxybenzaldehyde. InChIKey: GDOQJEBNBOJBQX-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 6-fluoro-2,3-dimethoxybenzaldehyde |
| InChIKey | GDOQJEBNBOJBQX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)C=O)OC |
Computed by PubChem (NCBI)