Products 457654-68-1
CAS 457654-68-1 appears in our catalog under these names: (R)-Methyl 2-amino-3-(3-nitrophenyl)propanoate hydrochloride, 97%, 3-Nitro-D-phenylalanine methyl ester hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
Methyl (2R)-2-amino-3-(3-nitrophenyl)propanoate;hydrochloride (CAS 457654-68-1) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(3-nitrophenyl)propanoate;hydrochloride. InChIKey: HQZBPSISFPOYIS-SBSPUUFOSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(3-nitrophenyl)propanoate;hydrochloride |
| InChIKey | HQZBPSISFPOYIS-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC(=CC=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)