Products 20299-36-9
CAS 20299-36-9 appears in our catalog under these names: 3-Nitro-L-phenylalanine methyl ester hydrochloride, 95%, 95%, Methyl (S)-2-amino-3-(3-nitrophenyl)propanoate hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2S)-2-amino-3-(3-nitrophenyl)propanoate;hydrochloride (CAS 20299-36-9) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3-nitrophenyl)propanoate;hydrochloride. InChIKey: HQZBPSISFPOYIS-FVGYRXGTSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3-nitrophenyl)propanoate;hydrochloride |
| InChIKey | HQZBPSISFPOYIS-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=CC=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)