Products 4582-21-2

CAS 4582-21-2 appears in our catalog under these names: 3,6-Endomethylene-1,2,3,6-tetrahydrophthaloyl chloride, 95%, TRANS-3,6-ENDOMETHYLENE-1,2,3,6-TETRAHY&. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 25g.

Bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride (CAS 4582-21-2) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride. InChIKey: KANQIAARVSWKKG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O2
Molecular weight219.06 g/mol
IUPAC namebicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride
InChIKeyKANQIAARVSWKKG-UHFFFAOYSA-N
SMILESC1C2C=CC1C(C2C(=O)Cl)C(=O)Cl

Computed by PubChem (NCBI)