CAS 4589-66-6 appears in our catalog under these names: (1,2–Dimethyl–1H–benzo(d)imidazol–5–yl)methanol, (1,2-Dimethyl-1H-benzo[d]imidazol-5-yl)methanol, 98%, 98%, (1,2-Dimethyl-1H-benzo[d]imidazol-5-yl)methanol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(1,2-dimethylbenzimidazol-5-yl)methanol (CAS 4589-66-6) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (1,2-dimethylbenzimidazol-5-yl)methanol. InChIKey: DTWCONPNVHZPJS-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (1,2-dimethylbenzimidazol-5-yl)methanol |
| InChIKey | DTWCONPNVHZPJS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C=CC(=C2)CO |
Computed by PubChem (NCBI)