Products 459180-57-5
CAS 459180-57-5 is the registry number for Sulfasalazine Impurity 22. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-chloro-3-methyl-N-pyridin-2-ylbenzenesulfonamide (CAS 459180-57-5) is a chemical compound with the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. IUPAC name: 4-chloro-3-methyl-N-pyridin-2-ylbenzenesulfonamide. InChIKey: WBGBVVKOACEBGE-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2S |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 4-chloro-3-methyl-N-pyridin-2-ylbenzenesulfonamide |
| InChIKey | WBGBVVKOACEBGE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)NC2=CC=CC=N2)Cl |
Computed by PubChem (NCBI)