CAS 460050-74-2 is the registry number for (2S,5S)–3–Methyl–2–phenyl–5–(phenylMethyl)–4–Imidazolidinone. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(2S,5S)-5-benzyl-3-methyl-2-phenylimidazolidin-4-one (CAS 460050-74-2) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: (2S,5S)-5-benzyl-3-methyl-2-phenylimidazolidin-4-one. InChIKey: SRAHHTPNHRABOU-HOTGVXAUSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | (2S,5S)-5-benzyl-3-methyl-2-phenylimidazolidin-4-one |
| InChIKey | SRAHHTPNHRABOU-HOTGVXAUSA-N |
| SMILES | CN1[C@H](N[C@H](C1=O)CC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)