CAS 460363-30-8 appears in our catalog under these names: 2-(Cyclopentylamino)nicotinic acid, 95+%, 2-(Cyclopentylamino)nicotinic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(cyclopentylamino)pyridine-3-carboxylic acid (CAS 460363-30-8) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 2-(cyclopentylamino)pyridine-3-carboxylic acid. InChIKey: BNPHCDCKTRSFKH-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-(cyclopentylamino)pyridine-3-carboxylic acid |
| InChIKey | BNPHCDCKTRSFKH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)