CAS 460745-20-4 is the registry number for Allyl 3-O-benzyl-a-L-rhamnopyranoside. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg.
(2S,3S,4R,5R,6R)-2-methyl-4-phenylmethoxy-6-prop-2-enoxyoxane-3,5-diol (CAS 460745-20-4) is a chemical compound with the molecular formula C16H22O5 and a molecular weight of 294.34 g/mol. IUPAC name: (2S,3S,4R,5R,6R)-2-methyl-4-phenylmethoxy-6-prop-2-enoxyoxane-3,5-diol. InChIKey: ZLLZSERZZNJPNG-RBRCJPGISA-N.
| Molecular formula | C16H22O5 |
|---|---|
| Molecular weight | 294.34 g/mol |
| IUPAC name | (2S,3S,4R,5R,6R)-2-methyl-4-phenylmethoxy-6-prop-2-enoxyoxane-3,5-diol |
| InChIKey | ZLLZSERZZNJPNG-RBRCJPGISA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OCC=C)O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)