CAS 461426-34-6 appears in our catalog under these names: N–(4–Aminobenzoyl)–L–glutamic acid–d4, N-(4-Aminobenzoyl)-L-glutamic acid-d4, 99.86%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10 mg, 1 mg, 5 mg.
(2S)-2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]pentanedioic acid (CAS 461426-34-6) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 270.27 g/mol. IUPAC name: (2S)-2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]pentanedioic acid. InChIKey: GADGMZDHLQLZRI-SGWYWVALSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 270.27 g/mol |
| IUPAC name | (2S)-2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]pentanedioic acid |
| InChIKey | GADGMZDHLQLZRI-SGWYWVALSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)[2H])[2H])N)[2H] |
Computed by PubChem (NCBI)