Products 4631-12-3
CAS 4631-12-3 appears in our catalog under these names: N-benzoyl-L-aspartic acid, 98%, N–benzoyl–L–aspartic acid, N-Benzoyl-L-aspartic acid, N-benzoyl-L-aspartic acid, 95%+, 95%+, N-benzoyl-L-aspartic acid, 99.89%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 25mg, 50mg, 500mg, 5g, 10g.
(2S)-2-benzamidobutanedioic acid (CAS 4631-12-3) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: (2S)-2-benzamidobutanedioic acid. InChIKey: DJLTZJGULPLVOA-QMMMGPOBSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | (2S)-2-benzamidobutanedioic acid |
| InChIKey | DJLTZJGULPLVOA-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)