Products 463355-64-8
CAS 463355-64-8 appears in our catalog under these names: 4-Bromo-3-(trifluoromethyl)benzoic acid ethyl ester, 95%, Ethyl 4-bromo-3-(trifluoromethyl)benzoate 95+%, Ethyl 4-bromo-3-(trifluoromethyl)benzoate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 100mg, 250mg.
Ethyl 4-bromo-3-(trifluoromethyl)benzoate (CAS 463355-64-8) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: ethyl 4-bromo-3-(trifluoromethyl)benzoate. InChIKey: WFVVYJMUQCKDEC-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | ethyl 4-bromo-3-(trifluoromethyl)benzoate |
| InChIKey | WFVVYJMUQCKDEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)