CAS 46376-16-3 appears in our catalog under these names: Phenylsulfonyl-sar-oh, 95%, 2-(N-Methylphenylsulfonamido)acetic acid, 98%, Phenylsulfonyl–Sar–OH, PHENYLSULFONYL-SAR-OH, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100mg.
2-[benzenesulfonyl(methyl)amino]acetic acid (CAS 46376-16-3) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2-[benzenesulfonyl(methyl)amino]acetic acid. InChIKey: XQGWHYCLQRSQSQ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2-[benzenesulfonyl(methyl)amino]acetic acid |
| InChIKey | XQGWHYCLQRSQSQ-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)