CAS 464930-76-5 appears in our catalog under these names: (R)–3–((tert–Butoxycarbonyl)amino)–3–(m–tolyl)propanoic acid, (R)-3-((tert-Butoxycarbonyl)amino)-3-(m-tolyl)propanoic acid, 97%, 97%, (R)-3-((tert-Butoxycarbonyl)amino)-3-(m-tolyl)propanoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(3R)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 464930-76-5) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (3R)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: XICHKLMIOJEDAM-GFCCVEGCSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (3R)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | XICHKLMIOJEDAM-GFCCVEGCSA-N |
| SMILES | CC1=CC(=CC=C1)[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)