CAS 499995-75-4 appears in our catalog under these names: (S)–3–((tert–Butoxycarbonyl)amino)–3–(m–tolyl)propanoic acid, Boc-(s)-3-amino-3-(3-methyl-phenyl)-propionic acid, 98%, 98%, (S)-3-((tert-Butoxycarbonyl)amino)-3-(m-tolyl)propanoic acid, 98%, H-β-D-Phe(3-Me)-OH, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 499995-75-4) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: XICHKLMIOJEDAM-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | XICHKLMIOJEDAM-LBPRGKRZSA-N |
| SMILES | CC1=CC(=CC=C1)[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)