CAS 46495-60-7 is the registry number for Alprazolam Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
(5-amino-2-chlorophenyl)-phenylmethanone (CAS 46495-60-7) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: (5-amino-2-chlorophenyl)-phenylmethanone. InChIKey: KZJVQORHPPEMBG-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | (5-amino-2-chlorophenyl)-phenylmethanone |
| InChIKey | KZJVQORHPPEMBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)N)Cl |
Computed by PubChem (NCBI)