Products 465514-67-4
CAS 465514-67-4 is the registry number for 4-(2-(3-Methoxyphenyl)acetyl)benzonitrile, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-[2-(3-methoxyphenyl)acetyl]benzonitrile (CAS 465514-67-4) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 4-[2-(3-methoxyphenyl)acetyl]benzonitrile. InChIKey: LJAFNBCCQCGQBV-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 4-[2-(3-methoxyphenyl)acetyl]benzonitrile |
| InChIKey | LJAFNBCCQCGQBV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CC(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)