CAS 4663-98-3 appears in our catalog under these names: 3,4-Pyridinedicarboxamide, 95%, Pyridine-3,4-dicarboxamide, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
Pyridine-3,4-dicarboxamide (CAS 4663-98-3) is a chemical compound with the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. IUPAC name: pyridine-3,4-dicarboxamide. InChIKey: JYUVRSQEAUFLHD-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | pyridine-3,4-dicarboxamide |
| InChIKey | JYUVRSQEAUFLHD-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(=O)N)C(=O)N |
Computed by PubChem (NCBI)