Products 467435-08-1
CAS 467435-08-1 appears in our catalog under these names: 2-(Trifluoromethyl)benzoylformic acid, 95%, 2-Oxo-2-(2-(trifluoromethyl)phenyl)acetic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-oxo-2-[2-(trifluoromethyl)phenyl]acetic acid (CAS 467435-08-1) is a chemical compound with the molecular formula C9H5F3O3 and a molecular weight of 218.13 g/mol. IUPAC name: 2-oxo-2-[2-(trifluoromethyl)phenyl]acetic acid. InChIKey: DRTPFGVZOCBBSC-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O3 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 2-oxo-2-[2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | DRTPFGVZOCBBSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)