CAS 4698-96-8 appears in our catalog under these names: 2-[(1,1'-Biphenyl-4-yloxy)methyl]oxirane, 95%, 2-(4-Phenylphenoxymethyl)oxirane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
2-[(4-phenylphenoxy)methyl]oxirane (CAS 4698-96-8) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2-[(4-phenylphenoxy)methyl]oxirane. InChIKey: GXANCFOKAWEPIS-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-[(4-phenylphenoxy)methyl]oxirane |
| InChIKey | GXANCFOKAWEPIS-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)