CAS 46988-94-7 appears in our catalog under these names: Boc-(S)-amino-(3-hydroxyphenyl)acetic acid, 95%, Boc-Phg(3-OH)-OH, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.
(2S)-2-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 46988-94-7) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: (2S)-2-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: OWZGHJNAVZKAIL-JTQLQIEISA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (2S)-2-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | OWZGHJNAVZKAIL-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC(=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)