Products 4714-25-4

CAS 4714-25-4 is the registry number for 2-Nitrostilbene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-nitro-2-(2-phenylethenyl)benzene (CAS 4714-25-4) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 1-nitro-2-(2-phenylethenyl)benzene. InChIKey: RYJATPLJVSILLB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11NO2
Molecular weight225.24 g/mol
IUPAC name1-nitro-2-(2-phenylethenyl)benzene
InChIKeyRYJATPLJVSILLB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C=CC2=CC=CC=C2[N+](=O)[O-]

Computed by PubChem (NCBI)