CAS 473476-99-2 is the registry number for 5-Chloro-N,N,2-trimethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-chloro-N,N,2-trimethylbenzenesulfonamide (CAS 473476-99-2) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: 5-chloro-N,N,2-trimethylbenzenesulfonamide. InChIKey: CRRKMBPWCSXDGH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 5-chloro-N,N,2-trimethylbenzenesulfonamide |
| InChIKey | CRRKMBPWCSXDGH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)