CAS 474-88-4 is the registry number for Equilenin Impurity 7. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(13S,14R)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one (CAS 474-88-4) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: (13S,14R)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one. InChIKey: PDRGHUMCVRDZLQ-AEFFLSMTSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | (13S,14R)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one |
| InChIKey | PDRGHUMCVRDZLQ-AEFFLSMTSA-N |
| SMILES | C[C@]12CCC3=C([C@H]1CCC2=O)C=CC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)