Products 56588-54-6
CAS 56588-54-6 appears in our catalog under these names: Equilenin-d3, Equilenin-d3, >95% (HPLC), Equilenin-4,16,16-d3, 97 atom % D, min 98% Chemical Purity, Equilenin-4,16,16-d3. Offered by: Hubei YoungXin, TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 0,01g, 0,005g.
(13S,14S)-4,16,16-trideuterio-3-hydroxy-13-methyl-11,12,14,15-tetrahydrocyclopenta[a]phenanthren-17-one (CAS 56588-54-6) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 269.4 g/mol. IUPAC name: (13S,14S)-4,16,16-trideuterio-3-hydroxy-13-methyl-11,12,14,15-tetrahydrocyclopenta[a]phenanthren-17-one. InChIKey: PDRGHUMCVRDZLQ-POWJHRNTSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | (13S,14S)-4,16,16-trideuterio-3-hydroxy-13-methyl-11,12,14,15-tetrahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | PDRGHUMCVRDZLQ-POWJHRNTSA-N |
| SMILES | [2H]C1=C(C=CC2=C1C=CC3=C2CC[C@]4([C@H]3CC(C4=O)([2H])[2H])C)O |
Computed by PubChem (NCBI)