Products 475-39-8
CAS 475-39-8 is the registry number for Bufothionine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(7,7-dimethyl-2-aza-7-azoniatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-9-yl) sulfate (CAS 475-39-8) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: (7,7-dimethyl-2-aza-7-azoniatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-9-yl) sulfate. InChIKey: VANPWLVSXXJWMF-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | (7,7-dimethyl-2-aza-7-azoniatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-9-yl) sulfate |
| InChIKey | VANPWLVSXXJWMF-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCC2=CNC3=C2C1=C(C=C3)OS(=O)(=O)[O-])C |
Computed by PubChem (NCBI)