CAS 476199-14-1 appears in our catalog under these names: 4-Methoxy-1-benzothiophene-2-carboxylic acid, 4-Methoxybenzo[b]thiophene-2-carboxylic acid, 96%, 96%, 4-Methoxybenzo[b]thiophene-2-carboxylic acid, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 500mg, 2.5g.
4-methoxy-1-benzothiophene-2-carboxylic acid (CAS 476199-14-1) is a chemical compound with the molecular formula C10H8O3S and a molecular weight of 208.24 g/mol. IUPAC name: 4-methoxy-1-benzothiophene-2-carboxylic acid. InChIKey: HTOLZPMMZRKTCP-UHFFFAOYSA-N.
| Molecular formula | C10H8O3S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 4-methoxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | HTOLZPMMZRKTCP-UHFFFAOYSA-N |
| SMILES | COC1=C2C=C(SC2=CC=C1)C(=O)O |
Computed by PubChem (NCBI)