Products 477199-79-4

CAS 477199-79-4 is the registry number for 3-Fluoro-4-(methoxymethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-4-(methoxymethyl)benzoic acid (CAS 477199-79-4) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 3-fluoro-4-(methoxymethyl)benzoic acid. InChIKey: RTMKJBUFKULHHT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO3
Molecular weight184.16 g/mol
IUPAC name3-fluoro-4-(methoxymethyl)benzoic acid
InChIKeyRTMKJBUFKULHHT-UHFFFAOYSA-N
SMILESCOCC1=C(C=C(C=C1)C(=O)O)F

Computed by PubChem (NCBI)