CAS 4776-00-5 appears in our catalog under these names: 4-Hydroxy-1,3-dioxaindane-5-carboxylic acid, 4-Hydroxybenzo(d)(1,3)dioxole-5-carboxylic acid, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 1g.
4-hydroxy-1,3-benzodioxole-5-carboxylic acid (CAS 4776-00-5) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 4-hydroxy-1,3-benzodioxole-5-carboxylic acid. InChIKey: SBMAXSKHTYXTKD-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-hydroxy-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | SBMAXSKHTYXTKD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)