CAS 478-95-5 appears in our catalog under these names: Methylergometrine EP impurity B, Methylergometrine maleate EP Impurity B, D-Isolysergic acid(controlled substance). Offered by: Chemat Brand. Available pack sizes: on request.
(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid (CAS 478-95-5) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: (6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid. InChIKey: ZAGRKAFMISFKIO-IINYFYTJSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid |
| InChIKey | ZAGRKAFMISFKIO-IINYFYTJSA-N |
| SMILES | CN1C[C@H](C=C2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)O |
Computed by PubChem (NCBI)