Products 478261-84-6
CAS 478261-84-6 is the registry number for 3-Chloro-n-(4-cyanophenyl)-2,2-dimethylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-chloro-N-(4-cyanophenyl)-2,2-dimethylpropanamide (CAS 478261-84-6) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: 3-chloro-N-(4-cyanophenyl)-2,2-dimethylpropanamide. InChIKey: NRWKXDZNPMTUCV-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 3-chloro-N-(4-cyanophenyl)-2,2-dimethylpropanamide |
| InChIKey | NRWKXDZNPMTUCV-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C(=O)NC1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)