Products 478314-67-9
CAS 478314-67-9 appears in our catalog under these names: 4–Hydroxymethylphenol 1–O–rhamnoside, 4-Hydroxymethylphenol 1-o-rhamnoside. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(2S,3R,4R,5R,6S)-2-[4-(hydroxymethyl)phenoxy]-6-methyloxane-3,4,5-triol (CAS 478314-67-9) is a chemical compound with the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. IUPAC name: (2S,3R,4R,5R,6S)-2-[4-(hydroxymethyl)phenoxy]-6-methyloxane-3,4,5-triol. InChIKey: VKJJAXLYSFNXBM-HPMQQCADSA-N.
| Molecular formula | C13H18O6 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (2S,3R,4R,5R,6S)-2-[4-(hydroxymethyl)phenoxy]-6-methyloxane-3,4,5-triol |
| InChIKey | VKJJAXLYSFNXBM-HPMQQCADSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)CO)O)O)O |
Computed by PubChem (NCBI)