CAS 478518-95-5 appears in our catalog under these names: 2-Deoxy-2-fluoro-D-(1-13C)glucose, 2-Deoxy-2-fluoro-D-glucose-13C. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 5 mg, 1 mg, 10 mg.
(3R,4S,5S,6R)-3-fluoro-6-(hydroxymethyl)(213C)oxane-2,4,5-triol (CAS 478518-95-5) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 183.14 g/mol. IUPAC name: (3R,4S,5S,6R)-3-fluoro-6-(hydroxymethyl)(213C)oxane-2,4,5-triol. InChIKey: ZCXUVYAZINUVJD-NQBVWVRGSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 183.14 g/mol |
| IUPAC name | (3R,4S,5S,6R)-3-fluoro-6-(hydroxymethyl)(213C)oxane-2,4,5-triol |
| InChIKey | ZCXUVYAZINUVJD-NQBVWVRGSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([13CH](O1)O)F)O)O)O |
Computed by PubChem (NCBI)