Products 4789-76-8
CAS 4789-76-8 is the registry number for 4-Methyl-2-phenylquinoline, 95+%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-methyl-2-phenylquinoline (CAS 4789-76-8) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 4-methyl-2-phenylquinoline. InChIKey: LPDYVLMKILCHDE-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 4-methyl-2-phenylquinoline |
| InChIKey | LPDYVLMKILCHDE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=CC=CC=C12)C3=CC=CC=C3 |
Computed by PubChem (NCBI)