Products 478954-83-5
CAS 478954-83-5 appears in our catalog under these names: Monobenzyl phthalate–d4, Monobenzyl Phthalate-d4, >95% (HPLC), mono-Benzyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Monobenzyl phthalate-d4, 99.35%. Offered by: GLPBio, TRC, CDN, MedChemExpress. Available pack sizes: 5mg, 50mg, 0,1g, 0,05g, 1mg, 10mg, 10 mg, 25 mg.
2,3,4,5-tetradeuterio-6-phenylmethoxycarbonylbenzoic acid (CAS 478954-83-5) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 260.28 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-phenylmethoxycarbonylbenzoic acid. InChIKey: XIKIUQUXDNHBFR-DOGSKSIHSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-phenylmethoxycarbonylbenzoic acid |
| InChIKey | XIKIUQUXDNHBFR-DOGSKSIHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC2=CC=CC=C2)[2H])[2H] |
Computed by PubChem (NCBI)