CAS 669713-75-1 appears in our catalog under these names: 3-Biphenyl-[1,3]dioxol-5-yl-acetic acid, 95%, 2-(3-(Benzo(d)(1,3)dioxol-5-yl)phenyl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 500mg, 250mg, 1g.
2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid (CAS 669713-75-1) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid. InChIKey: HDZYSLBSWPPUJY-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid |
| InChIKey | HDZYSLBSWPPUJY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CC=CC(=C3)CC(=O)O |
Computed by PubChem (NCBI)