Products 1365272-23-6

CAS 1365272-23-6 is the registry number for 3-[3-(Carboxymethyl)phenyl]benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-[3-(carboxymethyl)phenyl]benzoic acid (CAS 1365272-23-6) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 3-[3-(carboxymethyl)phenyl]benzoic acid. InChIKey: VRQGZJATEFPTFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12O4
Molecular weight256.25 g/mol
IUPAC name3-[3-(carboxymethyl)phenyl]benzoic acid
InChIKeyVRQGZJATEFPTFZ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)CC(=O)O

Computed by PubChem (NCBI)