CAS 56800-26-1 appears in our catalog under these names: 4-Formylphenyl 4-methoxybenzoate, 95%, 4-Formylphenyl 4-methoxybenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-formylphenyl) 4-methoxybenzoate (CAS 56800-26-1) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: (4-formylphenyl) 4-methoxybenzoate. InChIKey: VYORLHNCZWLOHJ-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (4-formylphenyl) 4-methoxybenzoate |
| InChIKey | VYORLHNCZWLOHJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)