Products 169209-25-0
CAS 169209-25-0 appears in our catalog under these names: 2-(Benzyloxy)-5-formylbenzoic acid, 98%, 2-(Benzyloxy)-5-formylbenzoic acid, 98%, 98%, 2-(Benzyloxy)-5-formylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-formyl-2-phenylmethoxybenzoic acid (CAS 169209-25-0) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 5-formyl-2-phenylmethoxybenzoic acid. InChIKey: FTTVXHXKTPOQDV-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 5-formyl-2-phenylmethoxybenzoic acid |
| InChIKey | FTTVXHXKTPOQDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C=O)C(=O)O |
Computed by PubChem (NCBI)