Products 4790-80-1

CAS 4790-80-1 is the registry number for 7-Hydroxy-1-benzofuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

7-hydroxy-1-benzofuran-2-carboxylic acid (CAS 4790-80-1) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 7-hydroxy-1-benzofuran-2-carboxylic acid. InChIKey: ADDCNCINMAVAMI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6O4
Molecular weight178.14 g/mol
IUPAC name7-hydroxy-1-benzofuran-2-carboxylic acid
InChIKeyADDCNCINMAVAMI-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)O)OC(=C2)C(=O)O

Computed by PubChem (NCBI)