CAS 479064-92-1 appears in our catalog under these names: Fmoc-D-β-Phe(4-Cl)-OH 95%, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-chlorophenyl)propanoic acid, 98%, 98%, Fmoc-(R)-3-Amino-3-(4-chlorophenyl)-propionic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(3R)-3-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 479064-92-1) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: (3R)-3-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: VDMPMJZDURHZTB-JOCHJYFZSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | (3R)-3-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | VDMPMJZDURHZTB-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)