CAS 4792-27-2 appears in our catalog under these names: 1-Oxo-1,3-dihydroisobenzofuran-4-carboxylic acid, 95+%, 1-Oxo-1,3-dihydro-2-benzofuran-4-carboxylic acid, 1-Oxo-1,3-dihydroisobenzofuran-4-carboxylic acid, 98%, 98%, 1-Oxo-1,3-dihydroisobenzofuran-4-carboxylic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 500mg.
1-oxo-3H-2-benzofuran-4-carboxylic acid (CAS 4792-27-2) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 1-oxo-3H-2-benzofuran-4-carboxylic acid. InChIKey: VBNXTCQFKJLUEQ-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 1-oxo-3H-2-benzofuran-4-carboxylic acid |
| InChIKey | VBNXTCQFKJLUEQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2C(=O)O)C(=O)O1 |
Computed by PubChem (NCBI)