CAS 480-13-7 is the registry number for Alpinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one (CAS 480-13-7) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one. InChIKey: QPOCKDYYXFOBCM-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 3,5-dihydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
| InChIKey | QPOCKDYYXFOBCM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC(C(C2=O)O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)