Products 480438-58-2
CAS 480438-58-2 appears in our catalog under these names: 2-Ethoxy-4-fluorophenylboronic acid 96%, 2-Ethoxy-4-fluorophenylboronic acid, 95%, 2-Ethoxy-4-fluorophenylboronic acid, 98%, 98%, 2–Ethoxy–4–fluorophenylboronic acid(Contains varying amounts of anhydride), 2-Ethoxy-4-fluorophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Ambeed, Fluorochem, Chemat, GLPBio, TCI. Available pack sizes: 5g, 10g, 25g, 100g, 250mg, 1g.
2-Ethoxy-4-fluorophenylboronic acid, 95%
Fluorochem- size: 250mg, 1g, 5g, 10g
- Variants: 6
from 107.27
(2-ethoxy-4-fluorophenyl)boronic acid (CAS 480438-58-2) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (2-ethoxy-4-fluorophenyl)boronic acid. InChIKey: WCJKVQYVILAKQW-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (2-ethoxy-4-fluorophenyl)boronic acid |
| InChIKey | WCJKVQYVILAKQW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Ethoxy-4-fluorophenylboronic Acid (contains varying amounts of Anhydride), 2-Ethoxy-4-fluorophenylboronic acid, (2-ethoxy-4-fluorophenyl)boronic acid, (2-ethoxy-4-fluoro-phenyl)boronic acid, 2-Ethoxy-4-fluorophenylboronic acid(Contains varying amounts of anhydride), WCJKVQYVILAKQW-UHFFFAOYSA-N