Products 4836-00-4
CAS 4836-00-4 appears in our catalog under these names: syn–2–Nitrobenzaldoxime, syn-2-Nitrobenzaldoxime [Deprotecting Agent], >85.0%(GC), [C(E)]-2-Nitrobenzaldehyde oxime, 85.0%, 85.0%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g.
(NE)-N-[(2-nitrophenyl)methylidene]hydroxylamine (CAS 4836-00-4) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: (NE)-N-[(2-nitrophenyl)methylidene]hydroxylamine. InChIKey: IHMGDCCTWRRUDX-VMPITWQZSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | (NE)-N-[(2-nitrophenyl)methylidene]hydroxylamine |
| InChIKey | IHMGDCCTWRRUDX-VMPITWQZSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Nitrobenzaldehyde oxime, Benzaldehyde, 2-nitro-, oxime, 2-Nitrobenzaldoxime, (E)-2-nitrobenzaldehyde oxime, o-Nitrobenzaldoxime, [C(E)]-2-Nitrobenzaldehyde oxime, Benzaldehyde, 2-nitro-, oxime, (E)-, (NE)-N-[(2-nitrophenyl)methylidene]hydroxylamine, syn-2-Nitrobenzaldoxime [Deprotecting Agent], (1E)-2-nitrobenzaldehyde oxime